C22H30ClN2O4+ — CID 20729289
[3,6-dibutoxy-4-(2-chloro-4-methoxyphenyl)-2-methoxyphenyl]iminoazanium (PubChem CID 20729289) has the molecular formula C22H30ClN2O4+ and a molecular weight of 421.95 g/mol. Its IUPAC name is [3,6-dibutoxy-4-(2-chloro-4-methoxyphenyl)-2-methoxyphenyl]iminoazanium.
| Compound Name | [3,6-dibutoxy-4-(2-chloro-4-methoxyphenyl)-2-methoxyphenyl]iminoazanium |
|---|---|
| PubChem CID | 20729289 |
| Molecular Formula | C22H30ClN2O4+ |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [3,6-dibutoxy-4-(2-chloro-4-methoxyphenyl)-2-methoxyphenyl]iminoazanium |
| SMILES | CCCCOc1cc(-c2ccc(OC)cc2Cl)c(OCCCC)c(OC)c1N=[NH2+] |
| InChI | InChI=1S/C22H29ClN2O4/c1-5-7-11-28-19-14-17(16-10-9-15(26-3)13-18(16)23)21(29-12-8-6-2)22(27-4)20(19)25-24/h9-10,13-14,24H,5-8,11-12H2,1-4H3/p+1 |
| InChIKey | BBYYZOFEHOOQCL-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|