C13H8Cl4O — CID 134628384
1,3,5-trichloro-2-(2-chloro-4-methoxyphenyl)benzene (PubChem CID 134628384) has the molecular formula C13H8Cl4O and a molecular weight of 322.02 g/mol. Its IUPAC name is 1,3,5-trichloro-2-(2-chloro-4-methoxyphenyl)benzene.
| Compound Name | 1,3,5-trichloro-2-(2-chloro-4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 134628384 |
| Molecular Formula | C13H8Cl4O |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 1,3,5-trichloro-2-(2-chloro-4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl4O/c1-18-8-2-3-9(10(15)6-8)13-11(16)4-7(14)5-12(13)17/h2-6H,1H3 |
| InChIKey | DBOGUXIRAXSRFT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |