C14H7Cl5F2O — CID 134617265
1,2,3,4,5-pentachloro-6-[2-(difluoromethyl)-4-methoxyphenyl]benzene (PubChem CID 134617265) has the molecular formula C14H7Cl5F2O and a molecular weight of 406.47 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[2-(difluoromethyl)-4-methoxyphenyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[2-(difluoromethyl)-4-methoxyphenyl]benzene |
|---|---|
| PubChem CID | 134617265 |
| Molecular Formula | C14H7Cl5F2O |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[2-(difluoromethyl)-4-methoxyphenyl]benzene |
| SMILES | COc1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(C(F)F)c1 |
| InChI | InChI=1S/C14H7Cl5F2O/c1-22-5-2-3-6(7(4-5)14(20)21)8-9(15)11(17)13(19)12(18)10(8)16/h2-4,14H,1H3 |
| InChIKey | LQPPCUULBGXFHZ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|