C9H8BrClF2O — CID 103514539
1-(1-bromo-2,2-difluoroethyl)-2-chloro-4-methoxybenzene (PubChem CID 103514539) has the molecular formula C9H8BrClF2O and a molecular weight of 285.51 g/mol. Its IUPAC name is 1-(1-bromo-2,2-difluoroethyl)-2-chloro-4-methoxybenzene.
| Compound Name | 1-(1-bromo-2,2-difluoroethyl)-2-chloro-4-methoxybenzene |
|---|---|
| PubChem CID | 103514539 |
| Molecular Formula | C9H8BrClF2O |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 1-(1-bromo-2,2-difluoroethyl)-2-chloro-4-methoxybenzene |
| SMILES | COc1ccc(C(Br)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H8BrClF2O/c1-14-5-2-3-6(7(11)4-5)8(10)9(12)13/h2-4,8-9H,1H3 |
| InChIKey | RZTLKVNOSQBSDE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|