C9H8ClF3O2 — CID 61081677
1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanol (PubChem CID 61081677) has the molecular formula C9H8ClF3O2 and a molecular weight of 240.61 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 61081677 |
| Molecular Formula | C9H8ClF3O2 |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanol |
| SMILES | COc1ccc(C(O)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClF3O2/c1-15-5-2-3-6(7(10)4-5)8(14)9(11,12)13/h2-4,8,14H,1H3 |
| InChIKey | XRDILTZZANPHPJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |