C9H9ClF3NO — CID 43561856
1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanamine (PubChem CID 43561856) has the molecular formula C9H9ClF3NO and a molecular weight of 239.62 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanamine.
| Compound Name | 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 43561856 |
| Molecular Formula | C9H9ClF3NO |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenyl)-2,2,2-trifluoroethanamine |
| SMILES | COc1ccc(C(N)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H9ClF3NO/c1-15-5-2-3-6(7(10)4-5)8(14)9(11,12)13/h2-4,8H,14H2,1H3 |
| InChIKey | CTOUHKGPBZISJU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |