C10H13ClO4 — CID 170817734
1-(2-chloro-4-methoxyphenyl)propane-1,2,3-triol (PubChem CID 170817734) has the molecular formula C10H13ClO4 and a molecular weight of 232.66 g/mol. Its IUPAC name is 1-(2-chloro-4-methoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-chloro-4-methoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817734 |
| Molecular Formula | C10H13ClO4 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(2-chloro-4-methoxyphenyl)propane-1,2,3-triol |
| SMILES | COc1ccc(C(O)C(O)CO)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClO4/c1-15-6-2-3-7(8(11)4-6)10(14)9(13)5-12/h2-4,9-10,12-14H,5H2,1H3 |
| InChIKey | HQIZCTVRUJYUFC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |