sodium 2-chloro-4-methoxyphenolate

C7H6ClNaO2 — CID 23710122

IUPACsodium 2-chloro-4-methoxyphenolate
SMILESCOc1ccc([O-])c(Cl)c1.[Na+]
InChIInChI=1S/C7H7ClO2.Na/c1-10-5-2-3-7(9)6(8)4-5;/h2-4,9H,1H3;/q;+1/p-1
InChIKeyCVQRCJFVHINAMU-UHFFFAOYSA-M
MW180.57 g/mol
LogP-1.57
Rot. Bonds1

About sodium 2-chloro-4-methoxyphenolate

sodium 2-chloro-4-methoxyphenolate (PubChem CID 23710122) has the molecular formula C7H6ClNaO2 and a molecular weight of 180.57 g/mol. Its IUPAC name is sodium 2-chloro-4-methoxyphenolate.

Molecular Properties

Compound Namesodium 2-chloro-4-methoxyphenolate
PubChem CID23710122
Molecular FormulaC7H6ClNaO2
Molecular Weight180.57 g/mol
Exact Mass180.00
IUPAC Namesodium 2-chloro-4-methoxyphenolate
SMILESCOc1ccc([O-])c(Cl)c1.[Na+]
InChIInChI=1S/C7H7ClO2.Na/c1-10-5-2-3-7(9)6(8)4-5;/h2-4,9H,1H3;/q;+1/p-1
InChIKeyCVQRCJFVHINAMU-UHFFFAOYSA-M
XLogP-1.57
TPSA32.29 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.57
LogP ≤ 5-1.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze sodium 2-chloro-4-methoxyphenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-chloro-4-methoxyphenolate?
The IUPAC name of sodium 2-chloro-4-methoxyphenolate (CID 23710122) is sodium 2-chloro-4-methoxyphenolate.
What is the SMILES notation for sodium 2-chloro-4-methoxyphenolate?
The canonical SMILES for sodium 2-chloro-4-methoxyphenolate is COc1ccc([O-])c(Cl)c1.[Na+].
What is the InChIKey of sodium 2-chloro-4-methoxyphenolate?
The InChIKey is CVQRCJFVHINAMU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7ClO2.Na/c1-10-5-2-3-7(9)6(8)4-5;/h2-4,9H,1H3;/q;+1/p-1.
What are the key properties of sodium 2-chloro-4-methoxyphenolate?
sodium 2-chloro-4-methoxyphenolate has a molecular weight of 180.57 g/mol, XLogP of -1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-chloro-4-methoxyphenolate is sourced from PubChem (CID 23710122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).