C32H36N2O2 — CID 86054718
4-[4-(4-cyanophenyl)-2,5-dihexoxyphenyl]benzonitrile (PubChem CID 86054718) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is 4-[4-(4-cyanophenyl)-2,5-dihexoxyphenyl]benzonitrile.
| Compound Name | 4-[4-(4-cyanophenyl)-2,5-dihexoxyphenyl]benzonitrile |
|---|---|
| PubChem CID | 86054718 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 4-[4-(4-cyanophenyl)-2,5-dihexoxyphenyl]benzonitrile |
| SMILES | CCCCCCOc1cc(-c2ccc(C#N)cc2)c(OCCCCCC)cc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C32H36N2O2/c1-3-5-7-9-19-35-31-21-30(28-17-13-26(24-34)14-18-28)32(36-20-10-8-6-4-2)22-29(31)27-15-11-25(23-33)12-16-27/h11-18,21-22H,3-10,19-20H2,1-2H3 |
| InChIKey | CVEFFQIBWCWMQT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|