C22H29Cl2N2O+ — CID 20729259
[2,3-dichloro-6-heptoxy-4-(2,4,6-trimethylphenyl)phenyl]iminoazanium (PubChem CID 20729259) has the molecular formula C22H29Cl2N2O+ and a molecular weight of 408.39 g/mol. Its IUPAC name is [2,3-dichloro-6-heptoxy-4-(2,4,6-trimethylphenyl)phenyl]iminoazanium.
| Compound Name | [2,3-dichloro-6-heptoxy-4-(2,4,6-trimethylphenyl)phenyl]iminoazanium |
|---|---|
| PubChem CID | 20729259 |
| Molecular Formula | C22H29Cl2N2O+ |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2,3-dichloro-6-heptoxy-4-(2,4,6-trimethylphenyl)phenyl]iminoazanium |
| SMILES | CCCCCCCOc1cc(-c2c(C)cc(C)cc2C)c(Cl)c(Cl)c1N=[NH2+] |
| InChI | InChI=1S/C22H28Cl2N2O/c1-5-6-7-8-9-10-27-18-13-17(20(23)21(24)22(18)26-25)19-15(3)11-14(2)12-16(19)4/h11-13,25H,5-10H2,1-4H3/p+1 |
| InChIKey | LDRHHORGNZTWOK-UHFFFAOYSA-O |
| XLogP | 6.78 |
| TPSA | 47.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|