C70H82O2 — CID 101402314
1,4-bis[(E)-2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethenyl]-2,5-dihexoxybenzene (PubChem CID 101402314) has the molecular formula C70H82O2 and a molecular weight of 955.42 g/mol. Its IUPAC name is 1,4-bis[(E)-2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethenyl]-2,5-dihexoxybenzene.
| Compound Name | 1,4-bis[(E)-2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethenyl]-2,5-dihexoxybenzene |
|---|---|
| PubChem CID | 101402314 |
| Molecular Formula | C70H82O2 |
| Molecular Weight | 955.42 g/mol |
| Exact Mass | 954.63 |
| IUPAC Name | 1,4-bis[(E)-2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethenyl]-2,5-dihexoxybenzene |
| SMILES | CCCCCCOc1cc(/C=C/c2c(-c3c(C)cc(C)cc3C)cccc2-c2c(C)cc(C)cc2C)c(OCCCCCC)cc1/C=C/c1c(-c2c(C)cc(C)cc2C)cccc1-c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C70H82O2/c1-15-17-19-21-33-71-65-43-58(30-32-60-63(69-53(11)39-47(5)40-54(69)12)27-24-28-64(60)70-55(13)41-48(6)42-56(70)14)66(72-34-22-20-18-16-2)44-57(65)29-31-59-61(67-49(7)35-45(3)36-50(67)8)25-23-26-62(59)68-51(9)37-46(4)38-52(68)10/h23-32,35-44H,15-22,33-34H2,1-14H3/b31-29+,32-30+ |
| InChIKey | YRDLTLGFWUDRCQ-JWTBXLROSA-N |
| XLogP | 20.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.42 |
| LogP ≤ 5 | 20.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|