C44H63F3O8S — CID 172837881
phenyl-bis(2,4,6-tributoxyphenyl)sulfanium;2,2,2-trifluoroacetate (PubChem CID 172837881) has the molecular formula C44H63F3O8S and a molecular weight of 809.04 g/mol. Its IUPAC name is phenyl-bis(2,4,6-tributoxyphenyl)sulfanium;2,2,2-trifluoroacetate.
| Compound Name | phenyl-bis(2,4,6-tributoxyphenyl)sulfanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 172837881 |
| Molecular Formula | C44H63F3O8S |
| Molecular Weight | 809.04 g/mol |
| Exact Mass | 808.42 |
| IUPAC Name | phenyl-bis(2,4,6-tributoxyphenyl)sulfanium;2,2,2-trifluoroacetate |
| SMILES | CCCCOc1cc(OCCCC)c([S+](c2ccccc2)c2c(OCCCC)cc(OCCCC)cc2OCCCC)c(OCCCC)c1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C42H63O6S.C2HF3O2/c1-7-13-24-43-34-30-37(45-26-15-9-3)41(38(31-34)46-27-16-10-4)49(36-22-20-19-21-23-36)42-39(47-28-17-11-5)32-35(44-25-14-8-2)33-40(42)48-29-18-12-6;3-2(4,5)1(6)7/h19-23,30-33H,7-18,24-29H2,1-6H3;(H,6,7)/q+1;/p-1 |
| InChIKey | WKBKEDBIDPLMPM-UHFFFAOYSA-M |
| XLogP | 11.15 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.04 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|