About ethyl 3-amino-5-ethoxybenzoate
ethyl 3-amino-5-ethoxybenzoate (PubChem CID 58424919) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is ethyl 3-amino-5-ethoxybenzoate.
Molecular Properties
| Compound Name | ethyl 3-amino-5-ethoxybenzoate |
| PubChem CID | 58424919 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethyl 3-amino-5-ethoxybenzoate |
| SMILES | CCOC(=O)c1cc(N)cc(OCC)c1 |
| InChI | InChI=1S/C11H15NO3/c1-3-14-10-6-8(5-9(12)7-10)11(13)15-4-2/h5-7H,3-4,12H2,1-2H3 |
| InChIKey | MIWBFHVQZWXFHU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-5-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-5-ethoxybenzoate?
The IUPAC name of ethyl 3-amino-5-ethoxybenzoate (CID 58424919) is ethyl 3-amino-5-ethoxybenzoate.
What is the SMILES notation for ethyl 3-amino-5-ethoxybenzoate?
The canonical SMILES for ethyl 3-amino-5-ethoxybenzoate is CCOC(=O)c1cc(N)cc(OCC)c1.
What is the InChIKey of ethyl 3-amino-5-ethoxybenzoate?
The InChIKey is MIWBFHVQZWXFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-3-14-10-6-8(5-9(12)7-10)11(13)15-4-2/h5-7H,3-4,12H2,1-2H3.
What are the key properties of ethyl 3-amino-5-ethoxybenzoate?
ethyl 3-amino-5-ethoxybenzoate has a molecular weight of 209.24 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-5-ethoxybenzoate is sourced from PubChem (CID 58424919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).