About (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate
(2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate (PubChem CID 81092527) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate |
| PubChem CID | 81092527 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate |
| SMILES | CCOC(=O)COC(=O)c1cc(N)cc(OCC)c1 |
| InChI | InChI=1S/C13H17NO5/c1-3-17-11-6-9(5-10(14)7-11)13(16)19-8-12(15)18-4-2/h5-7H,3-4,8,14H2,1-2H3 |
| InChIKey | GMSNEASWTLUTLH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate (CID 81092527) is (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate is CCOC(=O)COC(=O)c1cc(N)cc(OCC)c1.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate?
The InChIKey is GMSNEASWTLUTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-3-17-11-6-9(5-10(14)7-11)13(16)19-8-12(15)18-4-2/h5-7H,3-4,8,14H2,1-2H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate?
(2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate has a molecular weight of 267.28 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 3-amino-5-ethoxybenzoate is sourced from PubChem (CID 81092527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).