C14H18O4 — CID 155595563
1-(4-acetyl-3,5-diethoxyphenyl)ethanone (PubChem CID 155595563) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 1-(4-acetyl-3,5-diethoxyphenyl)ethanone.
| Compound Name | 1-(4-acetyl-3,5-diethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 155595563 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-(4-acetyl-3,5-diethoxyphenyl)ethanone |
| SMILES | CCOc1cc(C(C)=O)cc(OCC)c1C(C)=O |
| InChI | InChI=1S/C14H18O4/c1-5-17-12-7-11(9(3)15)8-13(18-6-2)14(12)10(4)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | AQEJOEYPAUZJDA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |