C15H24N2O5S — CID 23353685
2,4-diethoxy-N,N-diethyl-6-sulfamoylbenzamide (PubChem CID 23353685) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2,4-diethoxy-N,N-diethyl-6-sulfamoylbenzamide.
| Compound Name | 2,4-diethoxy-N,N-diethyl-6-sulfamoylbenzamide |
|---|---|
| PubChem CID | 23353685 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,4-diethoxy-N,N-diethyl-6-sulfamoylbenzamide |
| SMILES | CCOc1cc(OCC)c(C(=O)N(CC)CC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-5-17(6-2)15(18)14-12(22-8-4)9-11(21-7-3)10-13(14)23(16,19)20/h9-10H,5-8H2,1-4H3,(H2,16,19,20) |
| InChIKey | RMVUIQANGFYPKL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |