C15H22O7 — CID 129220874
3-[2,4,6-tris(methoxymethoxy)phenyl]propanal (PubChem CID 129220874) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-[2,4,6-tris(methoxymethoxy)phenyl]propanal.
| Compound Name | 3-[2,4,6-tris(methoxymethoxy)phenyl]propanal |
|---|---|
| PubChem CID | 129220874 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-[2,4,6-tris(methoxymethoxy)phenyl]propanal |
| SMILES | COCOc1cc(OCOC)c(CCC=O)c(OCOC)c1 |
| InChI | InChI=1S/C15H22O7/c1-17-9-20-12-7-14(21-10-18-2)13(5-4-6-16)15(8-12)22-11-19-3/h6-8H,4-5,9-11H2,1-3H3 |
| InChIKey | IIQQNBISDGAQIX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|