C12H14O3 — CID 83882748
1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)ethanone (PubChem CID 83882748) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)ethanone.
| Compound Name | 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)ethanone |
|---|---|
| PubChem CID | 83882748 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)ethanone |
| SMILES | CCOc1cc2c(cc1C(C)=O)OCC2 |
| InChI | InChI=1S/C12H14O3/c1-3-14-12-6-9-4-5-15-11(9)7-10(12)8(2)13/h6-7H,3-5H2,1-2H3 |
| InChIKey | KBSFCEVTPHCLSC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |