C11H12O3S — CID 66871442
1-(5-ethoxy-1,3-benzoxathiol-6-yl)ethanone (PubChem CID 66871442) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(5-ethoxy-1,3-benzoxathiol-6-yl)ethanone.
| Compound Name | 1-(5-ethoxy-1,3-benzoxathiol-6-yl)ethanone |
|---|---|
| PubChem CID | 66871442 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-(5-ethoxy-1,3-benzoxathiol-6-yl)ethanone |
| SMILES | CCOc1cc2c(cc1C(C)=O)OCS2 |
| InChI | InChI=1S/C11H12O3S/c1-3-13-9-5-11-10(14-6-15-11)4-8(9)7(2)12/h4-5H,3,6H2,1-2H3 |
| InChIKey | IJDCDGRJKXQZHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |