C13H19NO2 — CID 83890043
1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)propan-2-amine (PubChem CID 83890043) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)propan-2-amine.
| Compound Name | 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)propan-2-amine |
|---|---|
| PubChem CID | 83890043 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(5-ethoxy-2,3-dihydro-1-benzofuran-6-yl)propan-2-amine |
| SMILES | CCOc1cc2c(cc1CC(C)N)OCC2 |
| InChI | InChI=1S/C13H19NO2/c1-3-15-13-7-10-4-5-16-12(10)8-11(13)6-9(2)14/h7-9H,3-6,14H2,1-2H3 |
| InChIKey | JYDKPNJRKGQWKL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |