C11H15NO3 — CID 117298618
7-(2-aminopropyl)-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 117298618) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 7-(2-aminopropyl)-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-(2-aminopropyl)-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 117298618 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 7-(2-aminopropyl)-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | CC(N)Cc1cc2c(cc1O)OCCO2 |
| InChI | InChI=1S/C11H15NO3/c1-7(12)4-8-5-10-11(6-9(8)13)15-3-2-14-10/h5-7,13H,2-4,12H2,1H3 |
| InChIKey | FNELVTOWKMOHSY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |