About 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane
2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane (PubChem CID 67671436) has the molecular formula C11H17BrO4
and a molecular weight of 293.16 g/mol. Its IUPAC name is 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane.
Molecular Properties
| Compound Name | 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane |
| PubChem CID | 67671436 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane |
| SMILES | COCOCOC.Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C7H7BrO.C4H10O3/c1-5-2-3-7(9)6(8)4-5;1-5-3-7-4-6-2/h2-4,9H,1H3;3-4H2,1-2H3 |
| InChIKey | FXICYVLIXKNYJG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane?
The IUPAC name of 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane (CID 67671436) is 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane.
What is the SMILES notation for 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane?
The canonical SMILES for 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane is COCOCOC.Cc1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane?
The InChIKey is FXICYVLIXKNYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrO.C4H10O3/c1-5-2-3-7(9)6(8)4-5;1-5-3-7-4-6-2/h2-4,9H,1H3;3-4H2,1-2H3.
What are the key properties of 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane?
2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane has a molecular weight of 293.16 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methylphenol;methoxy(methoxymethoxy)methane is sourced from PubChem (CID 67671436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).