About 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane
2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane (PubChem CID 158942967) has the molecular formula C19H26Br2O5
and a molecular weight of 494.22 g/mol. Its IUPAC name is 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane.
Molecular Properties
| Compound Name | 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane |
| PubChem CID | 158942967 |
| Molecular Formula | C19H26Br2O5 |
| Molecular Weight | 494.22 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane |
| SMILES | COCOC.COCOc1ccc(C)cc1Br.Cc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C9H11BrO2.C7H7BrO.C3H8O2/c1-7-3-4-9(8(10)5-7)12-6-11-2;1-5-2-3-7(9)6(8)4-5;1-4-3-5-2/h3-5H,6H2,1-2H3;2-4,9H,1H3;3H2,1-2H3 |
| InChIKey | JKMDNCGLPHCHJB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.22 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane?
The IUPAC name of 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane (CID 158942967) is 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane.
What is the SMILES notation for 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane?
The canonical SMILES for 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane is COCOC.COCOc1ccc(C)cc1Br.Cc1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane?
The InChIKey is JKMDNCGLPHCHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO2.C7H7BrO.C3H8O2/c1-7-3-4-9(8(10)5-7)12-6-11-2;1-5-2-3-7(9)6(8)4-5;1-4-3-5-2/h3-5H,6H2,1-2H3;2-4,9H,1H3;3H2,1-2H3.
What are the key properties of 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane?
2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane has a molecular weight of 494.22 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(methoxymethoxy)-4-methylbenzene;2-bromo-4-methylphenol;dimethoxymethane is sourced from PubChem (CID 158942967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).