About 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol
2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol (PubChem CID 161031676) has the molecular formula C16H17Br3O2
and a molecular weight of 481.02 g/mol. Its IUPAC name is 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol.
Molecular Properties
| Compound Name | 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol |
| PubChem CID | 161031676 |
| Molecular Formula | C16H17Br3O2 |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 477.88 |
| IUPAC Name | 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol |
| SMILES | Cc1ccc(O)c(Br)c1.Cc1ccc(OCCBr)c(Br)c1 |
| InChI | InChI=1S/C9H10Br2O.C7H7BrO/c1-7-2-3-9(8(11)6-7)12-5-4-10;1-5-2-3-7(9)6(8)4-5/h2-3,6H,4-5H2,1H3;2-4,9H,1H3 |
| InChIKey | TZRXGRQFAVJBNX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol?
The IUPAC name of 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol (CID 161031676) is 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol.
What is the SMILES notation for 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol?
The canonical SMILES for 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol is Cc1ccc(O)c(Br)c1.Cc1ccc(OCCBr)c(Br)c1.
What is the InChIKey of 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol?
The InChIKey is TZRXGRQFAVJBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Br2O.C7H7BrO/c1-7-2-3-9(8(11)6-7)12-5-4-10;1-5-2-3-7(9)6(8)4-5/h2-3,6H,4-5H2,1H3;2-4,9H,1H3.
What are the key properties of 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol?
2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol has a molecular weight of 481.02 g/mol, XLogP of 5.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(2-bromoethoxy)-4-methylbenzene;2-bromo-4-methylphenol is sourced from PubChem (CID 161031676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).