C11H17NO — CID 145375645
ethane;5-methyl-2,3-dihydro-1-benzofuran-6-amine (PubChem CID 145375645) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydro-1-benzofuran-6-amine.
| Compound Name | ethane;5-methyl-2,3-dihydro-1-benzofuran-6-amine |
|---|---|
| PubChem CID | 145375645 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;5-methyl-2,3-dihydro-1-benzofuran-6-amine |
| SMILES | CC.Cc1cc2c(cc1N)OCC2 |
| InChI | InChI=1S/C9H11NO.C2H6/c1-6-4-7-2-3-11-9(7)5-8(6)10;1-2/h4-5H,2-3,10H2,1H3;1-2H3 |
| InChIKey | ASEKXVIPMFVVLT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|