C11H17NO2 — CID 145173589
ethane;7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 145173589) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is ethane;7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | ethane;7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 145173589 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | ethane;7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC.Cc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C9H11NO2.C2H6/c1-6-4-8-9(5-7(6)10)12-3-2-11-8;1-2/h4-5H,2-3,10H2,1H3;1-2H3 |
| InChIKey | WHRYSDAJECWERW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|