C8H9NO3 — CID 43164957
7-amino-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 43164957) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 7-amino-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-amino-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 43164957 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 7-amino-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | Nc1cc2c(cc1O)OCCO2 |
| InChI | InChI=1S/C8H9NO3/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h3-4,10H,1-2,9H2 |
| InChIKey | JCAVVLKPUGQVKH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|