C9H12N2O2 — CID 131107943
(4R)-4,6-diamino-3,4-dihydro-2H-chromen-7-ol (PubChem CID 131107943) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (4R)-4,6-diamino-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (4R)-4,6-diamino-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 131107943 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (4R)-4,6-diamino-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Nc1cc2c(cc1O)OCC[C@H]2N |
| InChI | InChI=1S/C9H12N2O2/c10-6-1-2-13-9-4-8(12)7(11)3-5(6)9/h3-4,6,12H,1-2,10-11H2/t6-/m1/s1 |
| InChIKey | ZCIBUNGBADGYAM-ZCFIWIBFSA-N |
| XLogP | 0.76 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|