C17H19NO3 — CID 43345537
6-(2,3,6-trimethylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 43345537) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 6-(2,3,6-trimethylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(2,3,6-trimethylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 43345537 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 6-(2,3,6-trimethylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Cc1ccc(C)c(Oc2cc3c(cc2N)OCCO3)c1C |
| InChI | InChI=1S/C17H19NO3/c1-10-4-5-11(2)17(12(10)3)21-14-9-16-15(8-13(14)18)19-6-7-20-16/h4-5,8-9H,6-7,18H2,1-3H3 |
| InChIKey | ILWLWFFVQUJHJO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|