C15H14FNO3 — CID 102980224
6-(5-fluoro-2-methylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 102980224) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 6-(5-fluoro-2-methylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-(5-fluoro-2-methylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 102980224 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 6-(5-fluoro-2-methylphenoxy)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Cc1ccc(F)cc1Oc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C15H14FNO3/c1-9-2-3-10(16)6-12(9)20-13-8-15-14(7-11(13)17)18-4-5-19-15/h2-3,6-8H,4-5,17H2,1H3 |
| InChIKey | VFHSCMPLVKVNGY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|