C13H12N2O3 — CID 43144876
6-pyridin-3-yloxy-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 43144876) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 6-pyridin-3-yloxy-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-pyridin-3-yloxy-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 43144876 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-pyridin-3-yloxy-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1Oc1cccnc1)OCCO2 |
| InChI | InChI=1S/C13H12N2O3/c14-10-6-12-13(17-5-4-16-12)7-11(10)18-9-2-1-3-15-8-9/h1-3,6-8H,4-5,14H2 |
| InChIKey | YWBSATNHFPMSNC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|