C14H14FNO — CID 62377840
2-(3,5-dimethylphenoxy)-4-fluoroaniline (PubChem CID 62377840) has the molecular formula C14H14FNO and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-4-fluoroaniline.
| Compound Name | 2-(3,5-dimethylphenoxy)-4-fluoroaniline |
|---|---|
| PubChem CID | 62377840 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-4-fluoroaniline |
| SMILES | Cc1cc(C)cc(Oc2cc(F)ccc2N)c1 |
| InChI | InChI=1S/C14H14FNO/c1-9-5-10(2)7-12(6-9)17-14-8-11(15)3-4-13(14)16/h3-8H,16H2,1-2H3 |
| InChIKey | PWFSBGYHJQWCTA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|