C14H14FNO3 — CID 62376643
2-(2,6-dimethoxyphenoxy)-4-fluoroaniline (PubChem CID 62376643) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-4-fluoroaniline.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-4-fluoroaniline |
|---|---|
| PubChem CID | 62376643 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-4-fluoroaniline |
| SMILES | COc1cccc(OC)c1Oc1cc(F)ccc1N |
| InChI | InChI=1S/C14H14FNO3/c1-17-11-4-3-5-12(18-2)14(11)19-13-8-9(15)6-7-10(13)16/h3-8H,16H2,1-2H3 |
| InChIKey | OEKQCYKHVOKSNW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|