C14H15NO3 — CID 57089933
3-(2,6-dimethoxyphenoxy)aniline (PubChem CID 57089933) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)aniline.
| Compound Name | 3-(2,6-dimethoxyphenoxy)aniline |
|---|---|
| PubChem CID | 57089933 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)aniline |
| SMILES | COc1cccc(OC)c1Oc1cccc(N)c1 |
| InChI | InChI=1S/C14H15NO3/c1-16-12-7-4-8-13(17-2)14(12)18-11-6-3-5-10(15)9-11/h3-9H,15H2,1-2H3 |
| InChIKey | KYHCAIPHWVNVKP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|