About 1-fluoro-2-methoxybenzene;3-methoxyaniline
1-fluoro-2-methoxybenzene;3-methoxyaniline (PubChem CID 174853611) has the molecular formula C14H16FNO2
and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-fluoro-2-methoxybenzene;3-methoxyaniline.
Molecular Properties
| Compound Name | 1-fluoro-2-methoxybenzene;3-methoxyaniline |
| PubChem CID | 174853611 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-fluoro-2-methoxybenzene;3-methoxyaniline |
| SMILES | COc1cccc(N)c1.COc1ccccc1F |
| InChI | InChI=1S/C7H7FO.C7H9NO/c1-9-7-5-3-2-4-6(7)8;1-9-7-4-2-3-6(8)5-7/h2-5H,1H3;2-5H,8H2,1H3 |
| InChIKey | ZVGKNXUXBSHPPB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-methoxybenzene;3-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methoxybenzene;3-methoxyaniline?
The IUPAC name of 1-fluoro-2-methoxybenzene;3-methoxyaniline (CID 174853611) is 1-fluoro-2-methoxybenzene;3-methoxyaniline.
What is the SMILES notation for 1-fluoro-2-methoxybenzene;3-methoxyaniline?
The canonical SMILES for 1-fluoro-2-methoxybenzene;3-methoxyaniline is COc1cccc(N)c1.COc1ccccc1F.
What is the InChIKey of 1-fluoro-2-methoxybenzene;3-methoxyaniline?
The InChIKey is ZVGKNXUXBSHPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.C7H9NO/c1-9-7-5-3-2-4-6(7)8;1-9-7-4-2-3-6(8)5-7/h2-5H,1H3;2-5H,8H2,1H3.
What are the key properties of 1-fluoro-2-methoxybenzene;3-methoxyaniline?
1-fluoro-2-methoxybenzene;3-methoxyaniline has a molecular weight of 249.28 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methoxybenzene;3-methoxyaniline is sourced from PubChem (CID 174853611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).