C12H9F2NO — CID 71424948
3-(2,4-difluorophenoxy)aniline (PubChem CID 71424948) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)aniline.
| Compound Name | 3-(2,4-difluorophenoxy)aniline |
|---|---|
| PubChem CID | 71424948 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-(2,4-difluorophenoxy)aniline |
| SMILES | Nc1cccc(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C12H9F2NO/c13-8-4-5-12(11(14)6-8)16-10-3-1-2-9(15)7-10/h1-7H,15H2 |
| InChIKey | ZOMLINWQGIQUJQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|