C24H21N3O3 — CID 19698881
3-[3,5-bis(3-aminophenoxy)phenoxy]aniline (PubChem CID 19698881) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[3,5-bis(3-aminophenoxy)phenoxy]aniline.
| Compound Name | 3-[3,5-bis(3-aminophenoxy)phenoxy]aniline |
|---|---|
| PubChem CID | 19698881 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[3,5-bis(3-aminophenoxy)phenoxy]aniline |
| SMILES | Nc1cccc(Oc2cc(Oc3cccc(N)c3)cc(Oc3cccc(N)c3)c2)c1 |
| InChI | InChI=1S/C24H21N3O3/c25-16-4-1-7-19(10-16)28-22-13-23(29-20-8-2-5-17(26)11-20)15-24(14-22)30-21-9-3-6-18(27)12-21/h1-15H,25-27H2 |
| InChIKey | JHYZHLNKNMVBSP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|