C24H24N4O2 — CID 158070504
4-[3-(4-aminophenoxy)phenoxy]aniline;benzene-1,4-diamine (PubChem CID 158070504) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[3-(4-aminophenoxy)phenoxy]aniline;benzene-1,4-diamine.
| Compound Name | 4-[3-(4-aminophenoxy)phenoxy]aniline;benzene-1,4-diamine |
|---|---|
| PubChem CID | 158070504 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-[3-(4-aminophenoxy)phenoxy]aniline;benzene-1,4-diamine |
| SMILES | Nc1ccc(N)cc1.Nc1ccc(Oc2cccc(Oc3ccc(N)cc3)c2)cc1 |
| InChI | InChI=1S/C18H16N2O2.C6H8N2/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16;7-5-1-2-6(8)4-3-5/h1-12H,19-20H2;1-4H,7-8H2 |
| InChIKey | FLTMOWAPPVBPLF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|