C11H8F2N2O — CID 28890071
4-(2,4-difluorophenoxy)pyridin-3-amine (PubChem CID 28890071) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)pyridin-3-amine.
| Compound Name | 4-(2,4-difluorophenoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 28890071 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4-(2,4-difluorophenoxy)pyridin-3-amine |
| SMILES | Nc1cnccc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C11H8F2N2O/c12-7-1-2-10(8(13)5-7)16-11-3-4-15-6-9(11)14/h1-6H,14H2 |
| InChIKey | KQLYLECGWQROLT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |