C16H19NO4 — CID 80752576
3-(2,6-dimethoxyphenoxy)-5-ethoxyaniline (PubChem CID 80752576) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenoxy)-5-ethoxyaniline.
| Compound Name | 3-(2,6-dimethoxyphenoxy)-5-ethoxyaniline |
|---|---|
| PubChem CID | 80752576 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-(2,6-dimethoxyphenoxy)-5-ethoxyaniline |
| SMILES | CCOc1cc(N)cc(Oc2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C16H19NO4/c1-4-20-12-8-11(17)9-13(10-12)21-16-14(18-2)6-5-7-15(16)19-3/h5-10H,4,17H2,1-3H3 |
| InChIKey | NWYPLKHPJOYWNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|