C15H16FNO3 — CID 64768237
2-[(2,6-dimethoxyphenoxy)methyl]-5-fluoroaniline (PubChem CID 64768237) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[(2,6-dimethoxyphenoxy)methyl]-5-fluoroaniline.
| Compound Name | 2-[(2,6-dimethoxyphenoxy)methyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 64768237 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(2,6-dimethoxyphenoxy)methyl]-5-fluoroaniline |
| SMILES | COc1cccc(OC)c1OCc1ccc(F)cc1N |
| InChI | InChI=1S/C15H16FNO3/c1-18-13-4-3-5-14(19-2)15(13)20-9-10-6-7-11(16)8-12(10)17/h3-8H,9,17H2,1-2H3 |
| InChIKey | BFXDQVVXKKXXNR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|