C17H18FNO2 — CID 64769409
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-5-fluoroaniline (PubChem CID 64769409) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-5-fluoroaniline.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 64769409 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-5-fluoroaniline |
| SMILES | CC1(C)Cc2cccc(OCc3ccc(F)cc3N)c2O1 |
| InChI | InChI=1S/C17H18FNO2/c1-17(2)9-11-4-3-5-15(16(11)21-17)20-10-12-6-7-13(18)8-14(12)19/h3-8H,9-10,19H2,1-2H3 |
| InChIKey | ZNZUIGZMMXMXNU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|