C16H15F2NO2 — CID 115507250
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4,6-difluoroaniline (PubChem CID 115507250) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4,6-difluoroaniline.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4,6-difluoroaniline |
|---|---|
| PubChem CID | 115507250 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-4,6-difluoroaniline |
| SMILES | CC1(C)Cc2cccc(Oc3cc(F)cc(F)c3N)c2O1 |
| InChI | InChI=1S/C16H15F2NO2/c1-16(2)8-9-4-3-5-12(15(9)21-16)20-13-7-10(17)6-11(18)14(13)19/h3-7H,8,19H2,1-2H3 |
| InChIKey | WDPBQHLGBMYIRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|