About [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine
[5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine (PubChem CID 62452781) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine |
| PubChem CID | 62452781 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine |
| SMILES | Cc1oc(COc2cccc3c2OC(C)(C)C3)cc1CN |
| InChI | InChI=1S/C17H21NO3/c1-11-13(9-18)7-14(20-11)10-19-15-6-4-5-12-8-17(2,3)21-16(12)15/h4-7H,8-10,18H2,1-3H3 |
| InChIKey | TXKYIQVJLGDVGL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine?
The IUPAC name of [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine (CID 62452781) is [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine.
What is the SMILES notation for [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine?
The canonical SMILES for [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine is Cc1oc(COc2cccc3c2OC(C)(C)C3)cc1CN.
What is the InChIKey of [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine?
The InChIKey is TXKYIQVJLGDVGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-11-13(9-18)7-14(20-11)10-19-15-6-4-5-12-8-17(2,3)21-16(12)15/h4-7H,8-10,18H2,1-3H3.
What are the key properties of [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine?
[5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine has a molecular weight of 287.36 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxymethyl]-2-methylfuran-3-yl]methanamine is sourced from PubChem (CID 62452781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).