C13H10Cl2FNO — CID 102980220
4,5-dichloro-2-(5-fluoro-2-methylphenoxy)aniline (PubChem CID 102980220) has the molecular formula C13H10Cl2FNO and a molecular weight of 286.13 g/mol. Its IUPAC name is 4,5-dichloro-2-(5-fluoro-2-methylphenoxy)aniline.
| Compound Name | 4,5-dichloro-2-(5-fluoro-2-methylphenoxy)aniline |
|---|---|
| PubChem CID | 102980220 |
| Molecular Formula | C13H10Cl2FNO |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 4,5-dichloro-2-(5-fluoro-2-methylphenoxy)aniline |
| SMILES | Cc1ccc(F)cc1Oc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C13H10Cl2FNO/c1-7-2-3-8(16)4-12(7)18-13-6-10(15)9(14)5-11(13)17/h2-6H,17H2,1H3 |
| InChIKey | NBQMRQOKILJNTD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|