C15H15BrN2O2 — CID 107633727
6-N-(3-bromo-2-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine (PubChem CID 107633727) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 6-N-(3-bromo-2-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine.
| Compound Name | 6-N-(3-bromo-2-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
|---|---|
| PubChem CID | 107633727 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-N-(3-bromo-2-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| SMILES | Cc1c(Br)cccc1Nc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C15H15BrN2O2/c1-9-10(16)3-2-4-12(9)18-13-8-15-14(7-11(13)17)19-5-6-20-15/h2-4,7-8,18H,5-6,17H2,1H3 |
| InChIKey | QAMBHROMHCCGLN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|