C16H18BrFN2O — CID 107633706
1-N-(3-bromo-2-methylphenyl)-4-fluoro-5-propoxybenzene-1,2-diamine (PubChem CID 107633706) has the molecular formula C16H18BrFN2O and a molecular weight of 353.24 g/mol. Its IUPAC name is 1-N-(3-bromo-2-methylphenyl)-4-fluoro-5-propoxybenzene-1,2-diamine.
| Compound Name | 1-N-(3-bromo-2-methylphenyl)-4-fluoro-5-propoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 107633706 |
| Molecular Formula | C16H18BrFN2O |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-N-(3-bromo-2-methylphenyl)-4-fluoro-5-propoxybenzene-1,2-diamine |
| SMILES | CCCOc1cc(Nc2cccc(Br)c2C)c(N)cc1F |
| InChI | InChI=1S/C16H18BrFN2O/c1-3-7-21-16-9-15(13(19)8-12(16)18)20-14-6-4-5-11(17)10(14)2/h4-6,8-9,20H,3,7,19H2,1-2H3 |
| InChIKey | YTDUOWRIVLEDIK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|