C14H12BrCl2FN2O — CID 107786999
2-N-(4-bromo-2,3-dichlorophenyl)-4-ethoxy-5-fluorobenzene-1,2-diamine (PubChem CID 107786999) has the molecular formula C14H12BrCl2FN2O and a molecular weight of 394.07 g/mol. Its IUPAC name is 2-N-(4-bromo-2,3-dichlorophenyl)-4-ethoxy-5-fluorobenzene-1,2-diamine.
| Compound Name | 2-N-(4-bromo-2,3-dichlorophenyl)-4-ethoxy-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 107786999 |
| Molecular Formula | C14H12BrCl2FN2O |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 2-N-(4-bromo-2,3-dichlorophenyl)-4-ethoxy-5-fluorobenzene-1,2-diamine |
| SMILES | CCOc1cc(Nc2ccc(Br)c(Cl)c2Cl)c(N)cc1F |
| InChI | InChI=1S/C14H12BrCl2FN2O/c1-2-21-12-6-11(9(19)5-8(12)18)20-10-4-3-7(15)13(16)14(10)17/h3-6,20H,2,19H2,1H3 |
| InChIKey | GTIMIKJOCAISEA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|