C15H14F2N2O2 — CID 103584526
6-N-(2,5-difluoro-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine (PubChem CID 103584526) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 6-N-(2,5-difluoro-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine.
| Compound Name | 6-N-(2,5-difluoro-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
|---|---|
| PubChem CID | 103584526 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-N-(2,5-difluoro-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| SMILES | Cc1cc(F)c(Nc2cc3c(cc2N)OCCO3)cc1F |
| InChI | InChI=1S/C15H14F2N2O2/c1-8-4-10(17)12(5-9(8)16)19-13-7-15-14(6-11(13)18)20-2-3-21-15/h4-7,19H,2-3,18H2,1H3 |
| InChIKey | CNCJPHSIHRSLHC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|