C14H12BrFN2O2 — CID 65437457
6-N-(4-bromo-3-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine (PubChem CID 65437457) has the molecular formula C14H12BrFN2O2 and a molecular weight of 339.16 g/mol. Its IUPAC name is 6-N-(4-bromo-3-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine.
| Compound Name | 6-N-(4-bromo-3-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
|---|---|
| PubChem CID | 65437457 |
| Molecular Formula | C14H12BrFN2O2 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 6-N-(4-bromo-3-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| SMILES | Nc1cc2c(cc1Nc1ccc(Br)c(F)c1)OCCO2 |
| InChI | InChI=1S/C14H12BrFN2O2/c15-9-2-1-8(5-10(9)16)18-12-7-14-13(6-11(12)17)19-3-4-20-14/h1-2,5-7,18H,3-4,17H2 |
| InChIKey | GFFAQDXJFMPLLO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|